C15H16F2N2O5S — CID 124737459
3-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propyl (2S)-2-hydroxypropanoate (PubChem CID 124737459) has the molecular formula C15H16F2N2O5S and a molecular weight of 374.37 g/mol. Its IUPAC name is 3-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propyl (2S)-2-hydroxypropanoate.
| Compound Name | 3-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propyl (2S)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 124737459 |
| Molecular Formula | C15H16F2N2O5S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 3-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propyl (2S)-2-hydroxypropanoate |
| SMILES | C[C@H](O)C(=O)OCCCSc1nnc(-c2ccc(OC(F)F)cc2)o1 |
| InChI | InChI=1S/C15H16F2N2O5S/c1-9(20)13(21)22-7-2-8-25-15-19-18-12(24-15)10-3-5-11(6-4-10)23-14(16)17/h3-6,9,14,20H,2,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | PSECRBIPAGTKBR-VIFPVBQESA-N |
| XLogP | 2.74 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|