C19H14ClN2O4S- — CID 8705888
(Z)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 8705888) has the molecular formula C19H14ClN2O4S- and a molecular weight of 401.85 g/mol. Its IUPAC name is (Z)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | (Z)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8705888 |
| Molecular Formula | C19H14ClN2O4S- |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (Z)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C(\Sc2nnc(-c3ccc(Cl)cc3)o2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H15ClN2O4S/c1-2-25-15-9-3-12(4-10-15)11-16(18(23)24)27-19-22-21-17(26-19)13-5-7-14(20)8-6-13/h3-11H,2H2,1H3,(H,23,24)/p-1/b16-11- |
| InChIKey | WBMMEURKBURPSH-WJDWOHSUSA-M |
| XLogP | 3.67 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|