C11H8ClN2O3S- — CID 7023539
3-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate (PubChem CID 7023539) has the molecular formula C11H8ClN2O3S- and a molecular weight of 283.72 g/mol. Its IUPAC name is 3-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate.
| Compound Name | 3-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 7023539 |
| Molecular Formula | C11H8ClN2O3S- |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 3-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoate |
| SMILES | O=C([O-])CCSc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C11H9ClN2O3S/c12-8-3-1-7(2-4-8)10-13-14-11(17-10)18-6-5-9(15)16/h1-4H,5-6H2,(H,15,16)/p-1 |
| InChIKey | FWSXCSDLUGQLPQ-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |