C17H14ClN3O4S — CID 55882412
2-(4-chlorophenyl)-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole (PubChem CID 55882412) has the molecular formula C17H14ClN3O4S and a molecular weight of 391.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-chlorophenyl)-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 55882412 |
| Molecular Formula | C17H14ClN3O4S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(OCCCSc2nnc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C17H14ClN3O4S/c18-13-4-2-12(3-5-13)16-19-20-17(25-16)26-11-1-10-24-15-8-6-14(7-9-15)21(22)23/h2-9H,1,10-11H2 |
| InChIKey | MRSFHGSXHCGVCX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|