C20H21N3O5S — CID 55884069
2-[(2,5-dimethylphenoxy)methyl]-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole (PubChem CID 55884069) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenoxy)methyl]-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(2,5-dimethylphenoxy)methyl]-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 55884069 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[(2,5-dimethylphenoxy)methyl]-5-[3-(4-nitrophenoxy)propylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1ccc(C)c(OCc2nnc(SCCCOc3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C20H21N3O5S/c1-14-4-5-15(2)18(12-14)27-13-19-21-22-20(28-19)29-11-3-10-26-17-8-6-16(7-9-17)23(24)25/h4-9,12H,3,10-11,13H2,1-2H3 |
| InChIKey | QKFIBGBAIVSLAU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|