C19H19ClN2O4S — CID 7648148
2-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 7648148) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7648148 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)propylsulfanyl]-5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(SCCCOc3ccc(Cl)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C19H19ClN2O4S/c1-23-15-8-9-16(17(12-15)24-2)18-21-22-19(26-18)27-11-3-10-25-14-6-4-13(20)5-7-14/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | HYBSKYKVHYTRAP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|