C20H19N5O4S — CID 16583344
2-(2,4-dimethoxyphenyl)-5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-oxadiazole (PubChem CID 16583344) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,4-dimethoxyphenyl)-5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 16583344 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(SCCCc3nc(-c4ccncc4)no3)o2)c(OC)c1 |
| InChI | InChI=1S/C20H19N5O4S/c1-26-14-5-6-15(16(12-14)27-2)19-23-24-20(28-19)30-11-3-4-17-22-18(25-29-17)13-7-9-21-10-8-13/h5-10,12H,3-4,11H2,1-2H3 |
| InChIKey | DBQMOEGXNRCRHG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 109.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|