C12H12N6OS2 — CID 16583200
5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 16583200) has the molecular formula C12H12N6OS2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 16583200 |
| Molecular Formula | C12H12N6OS2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(SCCCc2nc(-c3ccncc3)no2)s1 |
| InChI | InChI=1S/C12H12N6OS2/c13-11-16-17-12(21-11)20-7-1-2-9-15-10(18-19-9)8-3-5-14-6-4-8/h3-6H,1-2,7H2,(H2,13,16) |
| InChIKey | URDOWZSHUCAZHG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|