C16H13N5OS2 — CID 16583265
3-pyridin-4-yl-5-(3-thieno[2,3-d]pyrimidin-4-ylsulfanylpropyl)-1,2,4-oxadiazole (PubChem CID 16583265) has the molecular formula C16H13N5OS2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 3-pyridin-4-yl-5-(3-thieno[2,3-d]pyrimidin-4-ylsulfanylpropyl)-1,2,4-oxadiazole.
| Compound Name | 3-pyridin-4-yl-5-(3-thieno[2,3-d]pyrimidin-4-ylsulfanylpropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16583265 |
| Molecular Formula | C16H13N5OS2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 3-pyridin-4-yl-5-(3-thieno[2,3-d]pyrimidin-4-ylsulfanylpropyl)-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc(CCCSc3ncnc4sccc34)n2)ccn1 |
| InChI | InChI=1S/C16H13N5OS2/c1(8-23-15-12-5-9-24-16(12)19-10-18-15)2-13-20-14(21-22-13)11-3-6-17-7-4-11/h3-7,9-10H,1-2,8H2 |
| InChIKey | CTXMGCFFEAQHDH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|