C14H15ClN2O4S — CID 139557948
methyl 4-[[5-(2-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate (PubChem CID 139557948) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is methyl 4-[[5-(2-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate.
| Compound Name | methyl 4-[[5-(2-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 139557948 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | methyl 4-[[5-(2-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate |
| SMILES | COC(=O)CCCSc1nnc(-c2ccc(OC)cc2Cl)o1 |
| InChI | InChI=1S/C14H15ClN2O4S/c1-19-9-5-6-10(11(15)8-9)13-16-17-14(21-13)22-7-3-4-12(18)20-2/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | XNQAWGWYPBNREW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|