C12H11ClN2O4S — CID 139557966
4-[[5-(4-chloro-2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid (PubChem CID 139557966) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is 4-[[5-(4-chloro-2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid.
| Compound Name | 4-[[5-(4-chloro-2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 139557966 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-[[5-(4-chloro-2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSc1nnc(-c2ccc(Cl)cc2O)o1 |
| InChI | InChI=1S/C12H11ClN2O4S/c13-7-3-4-8(9(16)6-7)11-14-15-12(19-11)20-5-1-2-10(17)18/h3-4,6,16H,1-2,5H2,(H,17,18) |
| InChIKey | JPKWLPXGDRPCOG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|