C10H5F3N2O3S — CID 79749730
2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 79749730) has the molecular formula C10H5F3N2O3S and a molecular weight of 290.22 g/mol. Its IUPAC name is 2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 79749730 |
| Molecular Formula | C10H5F3N2O3S |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-[[5-(2,3,4-trifluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(-c2ccc(F)c(F)c2F)o1 |
| InChI | InChI=1S/C10H5F3N2O3S/c11-5-2-1-4(7(12)8(5)13)9-14-15-10(18-9)19-3-6(16)17/h1-2H,3H2,(H,16,17) |
| InChIKey | ZJWWGFCTTOYROL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|