C13H9N3O3S — CID 62876224
2-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (PubChem CID 62876224) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 62876224 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[(5-quinolin-5-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(-c2cccc3ncccc23)o1 |
| InChI | InChI=1S/C13H9N3O3S/c17-11(18)7-20-13-16-15-12(19-13)9-3-1-5-10-8(9)4-2-6-14-10/h1-6H,7H2,(H,17,18) |
| InChIKey | YCKQKDCPXIMZJB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |