C10H7IN2O3S — CID 29065783
2-[[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 29065783) has the molecular formula C10H7IN2O3S and a molecular weight of 362.15 g/mol. Its IUPAC name is 2-[[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 29065783 |
| Molecular Formula | C10H7IN2O3S |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 2-[[5-(2-iodophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(-c2ccccc2I)o1 |
| InChI | InChI=1S/C10H7IN2O3S/c11-7-4-2-1-3-6(7)9-12-13-10(16-9)17-5-8(14)15/h1-4H,5H2,(H,14,15) |
| InChIKey | OWMRYAXUUOMJKL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|