C16H19ClN2O4S — CID 139557940
tert-butyl 4-[[5-(2-chloro-4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate (PubChem CID 139557940) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is tert-butyl 4-[[5-(2-chloro-4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate.
| Compound Name | tert-butyl 4-[[5-(2-chloro-4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 139557940 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | tert-butyl 4-[[5-(2-chloro-4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCSc1nnc(-c2ccc(O)cc2Cl)o1 |
| InChI | InChI=1S/C16H19ClN2O4S/c1-16(2,3)23-13(21)5-4-8-24-15-19-18-14(22-15)11-7-6-10(20)9-12(11)17/h6-7,9,20H,4-5,8H2,1-3H3 |
| InChIKey | SXNLYJGWDPBTKM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|