C18H22Cl2N4OS — CID 175744348
2-(2,4-dichlorophenyl)-5-[6-(3-methyl-2H-imidazol-1-yl)hexylsulfanyl]-1,3,4-oxadiazole (PubChem CID 175744348) has the molecular formula C18H22Cl2N4OS and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-[6-(3-methyl-2H-imidazol-1-yl)hexylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,4-dichlorophenyl)-5-[6-(3-methyl-2H-imidazol-1-yl)hexylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 175744348 |
| Molecular Formula | C18H22Cl2N4OS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-[6-(3-methyl-2H-imidazol-1-yl)hexylsulfanyl]-1,3,4-oxadiazole |
| SMILES | CN1C=CN(CCCCCCSc2nnc(-c3ccc(Cl)cc3Cl)o2)C1 |
| InChI | InChI=1S/C18H22Cl2N4OS/c1-23-9-10-24(13-23)8-4-2-3-5-11-26-18-22-21-17(25-18)15-7-6-14(19)12-16(15)20/h6-7,9-10,12H,2-5,8,11,13H2,1H3 |
| InChIKey | GLGUIJOXLMGGRF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|