C12H10Cl2N2OS — CID 153350066
2-cyclobutylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole (PubChem CID 153350066) has the molecular formula C12H10Cl2N2OS and a molecular weight of 301.20 g/mol. Its IUPAC name is 2-cyclobutylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-cyclobutylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 153350066 |
| Molecular Formula | C12H10Cl2N2OS |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 2-cyclobutylsulfanyl-5-(2,4-dichlorophenyl)-1,3,4-oxadiazole |
| SMILES | Clc1ccc(-c2nnc(SC3CCC3)o2)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2OS/c13-7-4-5-9(10(14)6-7)11-15-16-12(17-11)18-8-2-1-3-8/h4-6,8H,1-3H2 |
| InChIKey | OMAKQROMTJDXNQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |