C19H21ClN2O4S — CID 139557916
tert-butyl 4-[[5-(2-chloro-4-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate (PubChem CID 139557916) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is tert-butyl 4-[[5-(2-chloro-4-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate.
| Compound Name | tert-butyl 4-[[5-(2-chloro-4-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 139557916 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | tert-butyl 4-[[5-(2-chloro-4-prop-2-ynoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butanoate |
| SMILES | C#CCOc1ccc(-c2nnc(SCCCC(=O)OC(C)(C)C)o2)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-5-10-24-13-8-9-14(15(20)12-13)17-21-22-18(25-17)27-11-6-7-16(23)26-19(2,3)4/h1,8-9,12H,6-7,10-11H2,2-4H3 |
| InChIKey | DBYQPSXJFDFUFT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|