C36H32N6O8 — CID 177495649
2-(4-nitrophenyl)-5-[4-[8-[4-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenoxy]octoxy]phenyl]-1,3,4-oxadiazole (PubChem CID 177495649) has the molecular formula C36H32N6O8 and a molecular weight of 676.69 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-[4-[8-[4-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenoxy]octoxy]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-nitrophenyl)-5-[4-[8-[4-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenoxy]octoxy]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 177495649 |
| Molecular Formula | C36H32N6O8 |
| Molecular Weight | 676.69 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | 2-(4-nitrophenyl)-5-[4-[8-[4-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]phenoxy]octoxy]phenyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(-c3ccc(OCCCCCCCCOc4ccc(-c5nnc(-c6ccc([N+](=O)[O-])cc6)o5)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C36H32N6O8/c43-41(44)29-15-7-25(8-16-29)33-37-39-35(49-33)27-11-19-31(20-12-27)47-23-5-3-1-2-4-6-24-48-32-21-13-28(14-22-32)36-40-38-34(50-36)26-9-17-30(18-10-26)42(45)46/h7-22H,1-6,23-24H2 |
| InChIKey | BFQNVYMVFBUDHP-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 182.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.69 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|