C16H11ClN2O4S — CID 7907080
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 7907080) has the molecular formula C16H11ClN2O4S and a molecular weight of 362.79 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 7907080 |
| Molecular Formula | C16H11ClN2O4S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)o1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H11ClN2O4S/c17-11-4-1-9(2-5-11)15-18-19-16(23-15)24-8-14(22)10-3-6-12(20)13(21)7-10/h1-7,20-21H,8H2 |
| InChIKey | LJQVJNGFRYYMSU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|