C15H15N2O5S- — CID 8706427
(Z)-3-(3-ethoxy-4-methoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate (PubChem CID 8706427) has the molecular formula C15H15N2O5S- and a molecular weight of 335.36 g/mol. Its IUPAC name is (Z)-3-(3-ethoxy-4-methoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate.
| Compound Name | (Z)-3-(3-ethoxy-4-methoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 8706427 |
| Molecular Formula | C15H15N2O5S- |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (Z)-3-(3-ethoxy-4-methoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C(\Sc2nnc(C)o2)C(=O)[O-])ccc1OC |
| InChI | InChI=1S/C15H16N2O5S/c1-4-21-12-7-10(5-6-11(12)20-3)8-13(14(18)19)23-15-17-16-9(2)22-15/h5-8H,4H2,1-3H3,(H,18,19)/p-1/b13-8- |
| InChIKey | HZCLCSWFKNQQMA-JYRVWZFOSA-M |
| XLogP | 1.67 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|