C12H8N3O5S- — CID 8706532
(E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 8706532) has the molecular formula C12H8N3O5S- and a molecular weight of 306.28 g/mol. Its IUPAC name is (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8706532 |
| Molecular Formula | C12H8N3O5S- |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | Cc1nnc(S/C(=C/c2ccc([N+](=O)[O-])cc2)C(=O)[O-])o1 |
| InChI | InChI=1S/C12H9N3O5S/c1-7-13-14-12(20-7)21-10(11(16)17)6-8-2-4-9(5-3-8)15(18)19/h2-6H,1H3,(H,16,17)/p-1/b10-6+ |
| InChIKey | OHLLXZPQBNOIDH-UXBLZVDNSA-M |
| XLogP | 1.17 |
| TPSA | 122.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|