C13H11N3O5S — CID 124666630
(Z)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid (PubChem CID 124666630) has the molecular formula C13H11N3O5S and a molecular weight of 321.31 g/mol. Its IUPAC name is (Z)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 124666630 |
| Molecular Formula | C13H11N3O5S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | (Z)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-nitrophenyl)prop-2-enoic acid |
| SMILES | CCc1nnc(S/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)O)o1 |
| InChI | InChI=1S/C13H11N3O5S/c1-2-11-14-15-13(21-11)22-10(12(17)18)7-8-3-5-9(6-4-8)16(19)20/h3-7H,2H2,1H3,(H,17,18)/b10-7- |
| InChIKey | AALQRAUNYYMLEA-YFHOEESVSA-N |
| XLogP | 2.76 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|