C19H15ClN2O3S — CID 9032892
(E)-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethylphenyl)prop-2-enoic acid (PubChem CID 9032892) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is (E)-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethylphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 9032892 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | (E)-2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(4-ethylphenyl)prop-2-enoic acid |
| SMILES | CCc1ccc(/C=C(/Sc2nnc(-c3ccccc3Cl)o2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H15ClN2O3S/c1-2-12-7-9-13(10-8-12)11-16(18(23)24)26-19-22-21-17(25-19)14-5-3-4-6-15(14)20/h3-11H,2H2,1H3,(H,23,24)/b16-11+ |
| InChIKey | PCFDINUMVBHJID-LFIBNONCSA-N |
| XLogP | 5.17 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|