C17H15ClN2O5S — CID 124666653
(Z)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid (PubChem CID 124666653) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is (Z)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 124666653 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (Z)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
| SMILES | C#CCOc1c(Cl)cc(/C=C(\Sc2nnc(CC)o2)C(=O)O)cc1OC |
| InChI | InChI=1S/C17H15ClN2O5S/c1-4-6-24-15-11(18)7-10(8-12(15)23-3)9-13(16(21)22)26-17-20-19-14(5-2)25-17/h1,7-9H,5-6H2,2-3H3,(H,21,22)/b13-9- |
| InChIKey | GIJKELMESIBXRL-LCYFTJDESA-N |
| XLogP | 3.52 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|