C16H12ClN2O5S- — CID 8706734
(E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate (PubChem CID 8706734) has the molecular formula C16H12ClN2O5S- and a molecular weight of 379.80 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 8706734 |
| Molecular Formula | C16H12ClN2O5S- |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
| SMILES | C#CCOc1c(Cl)cc(/C=C(/Sc2nnc(C)o2)C(=O)[O-])cc1OC |
| InChI | InChI=1S/C16H13ClN2O5S/c1-4-5-23-14-11(17)6-10(7-12(14)22-3)8-13(15(20)21)25-16-19-18-9(2)24-16/h1,6-8H,5H2,2-3H3,(H,20,21)/p-1/b13-8+ |
| InChIKey | YUBFTOIDEDQORP-MDWZMJQESA-M |
| XLogP | 1.94 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|