C14H14N2O5S — CID 8706422
(Z)-3-(3,4-dimethoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid (PubChem CID 8706422) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 8706422 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(\Sc2nnc(C)o2)C(=O)O)cc1OC |
| InChI | InChI=1S/C14H14N2O5S/c1-8-15-16-14(21-8)22-12(13(17)18)7-9-4-5-10(19-2)11(6-9)20-3/h4-7H,1-3H3,(H,17,18)/b12-7- |
| InChIKey | AVONTLAMNFBAAH-GHXNOFRVSA-N |
| XLogP | 2.61 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|