C13H10BrN2O5S- — CID 54716105
2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-6-methoxyphenolate (PubChem CID 54716105) has the molecular formula C13H10BrN2O5S- and a molecular weight of 386.20 g/mol. Its IUPAC name is 2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-6-methoxyphenolate.
| Compound Name | 2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-6-methoxyphenolate |
|---|---|
| PubChem CID | 54716105 |
| Molecular Formula | C13H10BrN2O5S- |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | 2-bromo-4-[(E)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-6-methoxyphenolate |
| SMILES | COc1cc(/C=C(/Sc2nnc(C)o2)C(=O)O)cc(Br)c1[O-] |
| InChI | InChI=1S/C13H11BrN2O5S/c1-6-15-16-13(21-6)22-10(12(18)19)5-7-3-8(14)11(17)9(4-7)20-2/h3-5,17H,1-2H3,(H,18,19)/p-1/b10-5+ |
| InChIKey | AUSCFZHRZXYIDZ-BJMVGYQFSA-M |
| XLogP | 2.44 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|