C19H15FN2O5S — CID 9033406
(E)-3-(3,4-dimethoxyphenyl)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid (PubChem CID 9033406) has the molecular formula C19H15FN2O5S and a molecular weight of 402.40 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 9033406 |
| Molecular Formula | C19H15FN2O5S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(/Sc2nnc(-c3ccc(F)cc3)o2)C(=O)O)cc1OC |
| InChI | InChI=1S/C19H15FN2O5S/c1-25-14-8-3-11(9-15(14)26-2)10-16(18(23)24)28-19-22-21-17(27-19)12-4-6-13(20)7-5-12/h3-10H,1-2H3,(H,23,24)/b16-10+ |
| InChIKey | XBOVZHWRVSIZDO-MHWRWJLKSA-N |
| XLogP | 4.11 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|