C18H12ClN2O5S- — CID 54702540
2-[(Z)-2-carboxy-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethenyl]-6-methoxyphenolate (PubChem CID 54702540) has the molecular formula C18H12ClN2O5S- and a molecular weight of 403.82 g/mol. Its IUPAC name is 2-[(Z)-2-carboxy-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethenyl]-6-methoxyphenolate.
| Compound Name | 2-[(Z)-2-carboxy-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethenyl]-6-methoxyphenolate |
|---|---|
| PubChem CID | 54702540 |
| Molecular Formula | C18H12ClN2O5S- |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 2-[(Z)-2-carboxy-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethenyl]-6-methoxyphenolate |
| SMILES | COc1cccc(/C=C(\Sc2nnc(-c3ccc(Cl)cc3)o2)C(=O)O)c1[O-] |
| InChI | InChI=1S/C18H13ClN2O5S/c1-25-13-4-2-3-11(15(13)22)9-14(17(23)24)27-18-21-20-16(26-18)10-5-7-12(19)8-6-10/h2-9,22H,1H3,(H,23,24)/p-1/b14-9- |
| InChIKey | JNLJFZWVWCIMMX-ZROIWOOFSA-M |
| XLogP | 3.69 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|