C18H12FN2O3S- — CID 9033426
(E)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(2-methylphenyl)prop-2-enoate (PubChem CID 9033426) has the molecular formula C18H12FN2O3S- and a molecular weight of 355.37 g/mol. Its IUPAC name is (E)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(2-methylphenyl)prop-2-enoate.
| Compound Name | (E)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9033426 |
| Molecular Formula | C18H12FN2O3S- |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (E)-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(2-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccccc1/C=C(/Sc1nnc(-c2ccc(F)cc2)o1)C(=O)[O-] |
| InChI | InChI=1S/C18H13FN2O3S/c1-11-4-2-3-5-13(11)10-15(17(22)23)25-18-21-20-16(24-18)12-6-8-14(19)9-7-12/h2-10H,1H3,(H,22,23)/p-1/b15-10+ |
| InChIKey | PZLUYAMWHBUCOT-XNTDXEJSSA-M |
| XLogP | 3.07 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|