C14H10N3O3S- — CID 8706410
(E)-3-(1H-indol-3-yl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate (PubChem CID 8706410) has the molecular formula C14H10N3O3S- and a molecular weight of 300.32 g/mol. Its IUPAC name is (E)-3-(1H-indol-3-yl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate.
| Compound Name | (E)-3-(1H-indol-3-yl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 8706410 |
| Molecular Formula | C14H10N3O3S- |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (E)-3-(1H-indol-3-yl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
| SMILES | Cc1nnc(S/C(=C/c2c[nH]c3ccccc23)C(=O)[O-])o1 |
| InChI | InChI=1S/C14H11N3O3S/c1-8-16-17-14(20-8)21-12(13(18)19)6-9-7-15-11-5-3-2-4-10(9)11/h2-7,15H,1H3,(H,18,19)/p-1/b12-6+ |
| InChIKey | GERCBPSGGFZEIO-WUXMJOGZSA-M |
| XLogP | 1.74 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|