C10H7N2O3S2- — CID 8706424
(E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-thiophen-2-ylprop-2-enoate (PubChem CID 8706424) has the molecular formula C10H7N2O3S2- and a molecular weight of 267.31 g/mol. Its IUPAC name is (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-thiophen-2-ylprop-2-enoate.
| Compound Name | (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8706424 |
| Molecular Formula | C10H7N2O3S2- |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | (E)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1nnc(S/C(=C/c2cccs2)C(=O)[O-])o1 |
| InChI | InChI=1S/C10H8N2O3S2/c1-6-11-12-10(15-6)17-8(9(13)14)5-7-3-2-4-16-7/h2-5H,1H3,(H,13,14)/p-1/b8-5+ |
| InChIKey | ZUVAZAYDKXSNAB-VMPITWQZSA-M |
| XLogP | 1.32 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|