C18H12N2O6S-2 — CID 8706622
4-[5-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-3-methylbenzoate (PubChem CID 8706622) has the molecular formula C18H12N2O6S-2 and a molecular weight of 384.37 g/mol. Its IUPAC name is 4-[5-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-3-methylbenzoate.
| Compound Name | 4-[5-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 8706622 |
| Molecular Formula | C18H12N2O6S-2 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-[5-[(Z)-2-carboxylato-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]furan-2-yl]-3-methylbenzoate |
| SMILES | Cc1nnc(S/C(=C\c2ccc(-c3ccc(C(=O)[O-])cc3C)o2)C(=O)[O-])o1 |
| InChI | InChI=1S/C18H14N2O6S/c1-9-7-11(16(21)22)3-5-13(9)14-6-4-12(26-14)8-15(17(23)24)27-18-20-19-10(2)25-18/h3-8H,1-2H3,(H,21,22)(H,23,24)/p-2/b15-8- |
| InChIKey | HHOVPTRONAKQFQ-NVNXTCNLSA-L |
| XLogP | 1.19 |
| TPSA | 132.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|