C18H15N3O6S — CID 8706482
(E)-3-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid (PubChem CID 8706482) has the molecular formula C18H15N3O6S and a molecular weight of 401.40 g/mol. Its IUPAC name is (E)-3-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 8706482 |
| Molecular Formula | C18H15N3O6S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | (E)-3-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
| SMILES | Cc1nnc(S/C(=C/c2ccc(-c3cc(C)c(C)c([N+](=O)[O-])c3)o2)C(=O)O)o1 |
| InChI | InChI=1S/C18H15N3O6S/c1-9-6-12(7-14(10(9)2)21(24)25)15-5-4-13(27-15)8-16(17(22)23)28-18-20-19-11(3)26-18/h4-8H,1-3H3,(H,22,23)/b16-8+ |
| InChIKey | ZGKZSAZDHMFXDX-LZYBPNLTSA-N |
| XLogP | 4.38 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|