C22H21N3O6 — CID 6109411
N-[(Z)-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 6109411) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-[(Z)-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(Z)-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 6109411 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[(Z)-[5-(3,4-dimethyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C\c2ccc(-c3cc(C)c(C)c([N+](=O)[O-])c3)o2)c1 |
| InChI | InChI=1S/C22H21N3O6/c1-13-7-15(10-20(14(13)2)25(27)28)21-6-5-17(31-21)12-23-24-22(26)16-8-18(29-3)11-19(9-16)30-4/h5-12H,1-4H3,(H,24,26)/b23-12- |
| InChIKey | ZJRZOXSVZAUQOJ-FMCGGJTJSA-N |
| XLogP | 4.25 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|