C13H11O4- — CID 6953179
4-[5-(hydroxymethyl)furan-2-yl]-3-methylbenzoate (PubChem CID 6953179) has the molecular formula C13H11O4- and a molecular weight of 231.23 g/mol. Its IUPAC name is 4-[5-(hydroxymethyl)furan-2-yl]-3-methylbenzoate.
| Compound Name | 4-[5-(hydroxymethyl)furan-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 6953179 |
| Molecular Formula | C13H11O4- |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-[5-(hydroxymethyl)furan-2-yl]-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)[O-])ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C13H12O4/c1-8-6-9(13(15)16)2-4-11(8)12-5-3-10(7-14)17-12/h2-6,14H,7H2,1H3,(H,15,16)/p-1 |
| InChIKey | DPPJBSCBFUJDEM-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |