C19H15N2O5- — CID 6959053
4-[5-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]furan-2-yl]-3-methylbenzoate (PubChem CID 6959053) has the molecular formula C19H15N2O5- and a molecular weight of 351.34 g/mol. Its IUPAC name is 4-[5-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]furan-2-yl]-3-methylbenzoate.
| Compound Name | 4-[5-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]furan-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 6959053 |
| Molecular Formula | C19H15N2O5- |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 4-[5-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]furan-2-yl]-3-methylbenzoate |
| SMILES | C=CCN1C(=O)N/C(=C/c2ccc(-c3ccc(C(=O)[O-])cc3C)o2)C1=O |
| InChI | InChI=1S/C19H16N2O5/c1-3-8-21-17(22)15(20-19(21)25)10-13-5-7-16(26-13)14-6-4-12(18(23)24)9-11(14)2/h3-7,9-10H,1,8H2,2H3,(H,20,25)(H,23,24)/p-1/b15-10+ |
| InChIKey | IUUFIWYGOFJTLQ-XNTDXEJSSA-M |
| XLogP | 1.70 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|