C18H14ClN2O5- — CID 7341547
4-chloro-3-[5-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 7341547) has the molecular formula C18H14ClN2O5- and a molecular weight of 373.77 g/mol. Its IUPAC name is 4-chloro-3-[5-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 4-chloro-3-[5-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7341547 |
| Molecular Formula | C18H14ClN2O5- |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-chloro-3-[5-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCCN1C(=O)N/C(=C/c2ccc(-c3cc(C(=O)[O-])ccc3Cl)o2)C1=O |
| InChI | InChI=1S/C18H15ClN2O5/c1-2-7-21-16(22)14(20-18(21)25)9-11-4-6-15(26-11)12-8-10(17(23)24)3-5-13(12)19/h3-6,8-9H,2,7H2,1H3,(H,20,25)(H,23,24)/p-1/b14-9+ |
| InChIKey | JWIVKCZBWJYDSZ-NTEUORMPSA-M |
| XLogP | 2.27 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|