C16H13N3O5 — CID 126243794
(5Z)-3-ethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126243794) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is (5Z)-3-ethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-ethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126243794 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (5Z)-3-ethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C\c2ccc(-c3ccccc3[N+](=O)[O-])o2)C1=O |
| InChI | InChI=1S/C16H13N3O5/c1-2-18-15(20)12(17-16(18)21)9-10-7-8-14(24-10)11-5-3-4-6-13(11)19(22)23/h3-9H,2H2,1H3,(H,17,21)/b12-9- |
| InChIKey | KDPYKFLTBOUAHA-XFXZXTDPSA-N |
| XLogP | 2.77 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|