C14H9N3O5 — CID 3096631
5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 3096631) has the molecular formula C14H9N3O5 and a molecular weight of 299.24 g/mol. Its IUPAC name is 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3096631 |
| Molecular Formula | C14H9N3O5 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(-c3ccccc3[N+](=O)[O-])o2)N1 |
| InChI | InChI=1S/C14H9N3O5/c18-13-10(15-14(19)16-13)7-8-5-6-12(22-8)9-3-1-2-4-11(9)17(20)21/h1-7H,(H2,15,16,18,19) |
| InChIKey | KXLJHGDTICKFAU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|