C21H13NO7 — CID 1341220
5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 1341220) has the molecular formula C21H13NO7 and a molecular weight of 391.34 g/mol. Its IUPAC name is 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 1341220 |
| Molecular Formula | C21H13NO7 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | O=C1OC(c2ccccc2)OC(=O)C1=Cc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H13NO7/c23-19-16(20(24)29-21(28-19)13-6-2-1-3-7-13)12-14-10-11-18(27-14)15-8-4-5-9-17(15)22(25)26/h1-12,21H/b16-12- |
| InChIKey | YBEZJYXCPQMYMB-VBKFSLOCSA-N |
| XLogP | 4.04 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|