C22H15NO8 — CID 21212643
5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 21212643) has the molecular formula C22H15NO8 and a molecular weight of 421.36 g/mol. Its IUPAC name is 5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 21212643 |
| Molecular Formula | C22H15NO8 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C=C2C(=O)OC(c3ccccc3)OC2=O)o1 |
| InChI | InChI=1S/C22H15NO8/c1-28-19-11-14(23(26)27)7-9-16(19)18-10-8-15(29-18)12-17-20(24)30-22(31-21(17)25)13-5-3-2-4-6-13/h2-12,22H,1H3/b17-12- |
| InChIKey | BTIPXSSVMXFIQP-ATVHPVEESA-N |
| XLogP | 4.05 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|