C22H15N3O7 — CID 2263705
(5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 2263705) has the molecular formula C22H15N3O7 and a molecular weight of 433.38 g/mol. Its IUPAC name is (5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2263705 |
| Molecular Formula | C22H15N3O7 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (5E)-5-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(/C=C2\C(=O)NC(=O)N(c3ccccc3)C2=O)o1 |
| InChI | InChI=1S/C22H15N3O7/c1-31-19-11-14(25(29)30)7-9-16(19)18-10-8-15(32-18)12-17-20(26)23-22(28)24(21(17)27)13-5-3-2-4-6-13/h2-12H,1H3,(H,23,26,28)/b17-12+ |
| InChIKey | OUYLNXHZDVZGHC-SFQUDFHCSA-N |
| XLogP | 3.53 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|