C20H13N3O7 — CID 124549322
(5Z)-1-(furan-2-ylmethyl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124549322) has the molecular formula C20H13N3O7 and a molecular weight of 407.34 g/mol. Its IUPAC name is (5Z)-1-(furan-2-ylmethyl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(furan-2-ylmethyl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124549322 |
| Molecular Formula | C20H13N3O7 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (5Z)-1-(furan-2-ylmethyl)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(Cc2ccco2)C(=O)/C1=C\c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C20H13N3O7/c24-18-15(19(25)22(20(26)21-18)11-13-4-3-9-29-13)10-12-7-8-17(30-12)14-5-1-2-6-16(14)23(27)28/h1-10H,11H2,(H,21,24,26)/b15-10- |
| InChIKey | FUJJXUMLIPYVPI-GDNBJRDFSA-N |
| XLogP | 3.11 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|