C16H12ClN3O5 — CID 126241446
(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126241446) has the molecular formula C16H12ClN3O5 and a molecular weight of 361.74 g/mol. Its IUPAC name is (5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126241446 |
| Molecular Formula | C16H12ClN3O5 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o2)C1=O |
| InChI | InChI=1S/C16H12ClN3O5/c1-2-19-15(21)12(18-16(19)22)8-10-4-6-14(25-10)11-5-3-9(17)7-13(11)20(23)24/h3-8H,2H2,1H3,(H,18,22)/b12-8+ |
| InChIKey | AVOAMADMOQXONZ-XYOKQWHBSA-N |
| XLogP | 3.42 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|