C20H11Cl2N3O5 — CID 126246526
(5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 126246526) has the molecular formula C20H11Cl2N3O5 and a molecular weight of 444.23 g/mol. Its IUPAC name is (5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126246526 |
| Molecular Formula | C20H11Cl2N3O5 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (5E)-5-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H11Cl2N3O5/c21-11-1-4-13(5-2-11)24-19(26)16(23-20(24)27)10-14-6-8-18(30-14)15-7-3-12(22)9-17(15)25(28)29/h1-10H,(H,23,27)/b16-10+ |
| InChIKey | GSGILFWMAKJHHV-MHWRWJLKSA-N |
| XLogP | 5.26 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|