C21H15N3O5 — CID 126017600
(5E)-5-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 126017600) has the molecular formula C21H15N3O5 and a molecular weight of 389.37 g/mol. Its IUPAC name is (5E)-5-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126017600 |
| Molecular Formula | C21H15N3O5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (5E)-5-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=C2/NC(=O)N(c3ccccc3)C2=O)o1 |
| InChI | InChI=1S/C21H15N3O5/c1-13-7-8-15(24(27)28)11-17(13)19-10-9-16(29-19)12-18-20(25)23(21(26)22-18)14-5-3-2-4-6-14/h2-12H,1H3,(H,22,26)/b18-12+ |
| InChIKey | FHYZTBDLEDIOCQ-LDADJPATSA-N |
| XLogP | 4.26 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|