C22H14ClFN2O5 — CID 1308766
4-chloro-3-[5-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 1308766) has the molecular formula C22H14ClFN2O5 and a molecular weight of 440.81 g/mol. Its IUPAC name is 4-chloro-3-[5-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1308766 |
| Molecular Formula | C22H14ClFN2O5 |
| Molecular Weight | 440.81 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 4-chloro-3-[5-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2ccc(C=C3NC(=O)N(Cc4ccccc4F)C3=O)o2)c1 |
| InChI | InChI=1S/C22H14ClFN2O5/c23-16-7-5-12(21(28)29)9-15(16)19-8-6-14(31-19)10-18-20(27)26(22(30)25-18)11-13-3-1-2-4-17(13)24/h1-10H,11H2,(H,25,30)(H,28,29) |
| InChIKey | DOLGBNSHCVNTMI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.81 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|