C21H14BrFN2O3 — CID 1021159
5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 1021159) has the molecular formula C21H14BrFN2O3 and a molecular weight of 441.26 g/mol. Its IUPAC name is 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1021159 |
| Molecular Formula | C21H14BrFN2O3 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 5-[[5-(4-bromophenyl)furan-2-yl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=Cc2ccc(-c3ccc(Br)cc3)o2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C21H14BrFN2O3/c22-15-7-5-13(6-8-15)19-10-9-16(28-19)11-18-20(26)25(21(27)24-18)12-14-3-1-2-4-17(14)23/h1-11H,12H2,(H,24,27) |
| InChIKey | NHURIUDAUCYHHY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|